C20H19N6NaO8S — CID 23717272
sodium (2S,5R,6R)-6-[[2-[(3,5-dioxo-2H-1,2,4-triazine-6-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23717272) has the molecular formula C20H19N6NaO8S and a molecular weight of 526.46 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-[[2-[(3,5-dioxo-2H-1,2,4-triazine-6-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-[[2-[(3,5-dioxo-2H-1,2,4-triazine-6-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23717272 |
| Molecular Formula | C20H19N6NaO8S |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | sodium (2S,5R,6R)-6-[[2-[(3,5-dioxo-2H-1,2,4-triazine-6-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C(NC(=O)c3n[nH]c(=O)[nH]c3=O)c3ccc(O)cc3)C(=O)N2[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H20N6O8S.Na/c1-20(2)12(18(32)33)26-16(31)11(17(26)35-20)22-13(28)9(7-3-5-8(27)6-4-7)21-14(29)10-15(30)23-19(34)25-24-10;/h3-6,9,11-12,17,27H,1-2H3,(H,21,29)(H,22,28)(H,32,33)(H2,23,25,30,34);/q;+1/p-1/t9?,11-,12+,17-;/m1./s1 |
| InChIKey | VCUIZWKRVMHEJU-ZEHACKGFSA-M |
| XLogP | -6.06 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | -6.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |