C22H24N6O9S — CID 70630595
methoxymethyl (2S,5R,6R)-6-[[2-[(3,5-dioxo-2H-1,2,4-triazine-6-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70630595) has the molecular formula C22H24N6O9S and a molecular weight of 548.53 g/mol. Its IUPAC name is methoxymethyl (2S,5R,6R)-6-[[2-[(3,5-dioxo-2H-1,2,4-triazine-6-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | methoxymethyl (2S,5R,6R)-6-[[2-[(3,5-dioxo-2H-1,2,4-triazine-6-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70630595 |
| Molecular Formula | C22H24N6O9S |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | methoxymethyl (2S,5R,6R)-6-[[2-[(3,5-dioxo-2H-1,2,4-triazine-6-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COCOC(=O)[C@@H]1N2C(=O)[C@@H](NC(=O)C(NC(=O)c3n[nH]c(=O)[nH]c3=O)c3ccc(O)cc3)[C@H]2SC1(C)C |
| InChI | InChI=1S/C22H24N6O9S/c1-22(2)14(20(34)37-8-36-3)28-18(33)13(19(28)38-22)24-15(30)11(9-4-6-10(29)7-5-9)23-16(31)12-17(32)25-21(35)27-26-12/h4-7,11,13-14,19,29H,8H2,1-3H3,(H,23,31)(H,24,30)(H2,25,27,32,35)/t11?,13-,14+,19-/m1/s1 |
| InChIKey | WJSQSHWFBKSZLT-FZJJXPKWSA-N |
| XLogP | -1.67 |
| TPSA | 212.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|