C28H23BrN2O3S — CID 2371763
[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 2-(1-bromonaphthalen-2-yl)sulfanylacetate (PubChem CID 2371763) has the molecular formula C28H23BrN2O3S and a molecular weight of 547.47 g/mol. Its IUPAC name is [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 2-(1-bromonaphthalen-2-yl)sulfanylacetate.
| Compound Name | [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 2-(1-bromonaphthalen-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 2371763 |
| Molecular Formula | C28H23BrN2O3S |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 2-(1-bromonaphthalen-2-yl)sulfanylacetate |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)COC(=O)CSc3ccc4ccccc4c3Br)ccc21 |
| InChI | InChI=1S/C28H23BrN2O3S/c1-2-31-23-10-6-5-9-21(23)22-15-19(12-13-24(22)31)30-26(32)16-34-27(33)17-35-25-14-11-18-7-3-4-8-20(18)28(25)29/h3-15H,2,16-17H2,1H3,(H,30,32) |
| InChIKey | ZNOFEWJTFLJPQK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |