C11H16N2OS — CID 2371890
N-cyclohexyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2371890) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-cyclohexyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | N-cyclohexyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2371890 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-cyclohexyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)N(c1nccs1)C1CCCCC1 |
| InChI | InChI=1S/C11H16N2OS/c1-9(14)13(11-12-7-8-15-11)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3 |
| InChIKey | ONSIDRFBJVWMSR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |