C7H8N2OS — CID 574609
1-(1,3-thiazol-2-yl)pyrrolidin-2-one (PubChem CID 574609) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 1-(1,3-thiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 574609 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1nccs1 |
| InChI | InChI=1S/C7H8N2OS/c10-6-2-1-4-9(6)7-8-3-5-11-7/h3,5H,1-2,4H2 |
| InChIKey | NSPIBVRMSCXUFE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |