About carbonic acid;4-(2-chlorophenoxy)piperidine
carbonic acid;4-(2-chlorophenoxy)piperidine (PubChem CID 23722971) has the molecular formula C12H16ClNO4
and a molecular weight of 273.72 g/mol. Its IUPAC name is carbonic acid;4-(2-chlorophenoxy)piperidine.
Molecular Properties
| Compound Name | carbonic acid;4-(2-chlorophenoxy)piperidine |
| PubChem CID | 23722971 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | carbonic acid;4-(2-chlorophenoxy)piperidine |
| SMILES | Clc1ccccc1OC1CCNCC1.O=C(O)O |
| InChI | InChI=1S/C11H14ClNO.CH2O3/c12-10-3-1-2-4-11(10)14-9-5-7-13-8-6-9;2-1(3)4/h1-4,9,13H,5-8H2;(H2,2,3,4) |
| InChIKey | RSCVWMNPWCORJY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;4-(2-chlorophenoxy)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;4-(2-chlorophenoxy)piperidine?
The IUPAC name of carbonic acid;4-(2-chlorophenoxy)piperidine (CID 23722971) is carbonic acid;4-(2-chlorophenoxy)piperidine.
What is the SMILES notation for carbonic acid;4-(2-chlorophenoxy)piperidine?
The canonical SMILES for carbonic acid;4-(2-chlorophenoxy)piperidine is Clc1ccccc1OC1CCNCC1.O=C(O)O.
What is the InChIKey of carbonic acid;4-(2-chlorophenoxy)piperidine?
The InChIKey is RSCVWMNPWCORJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO.CH2O3/c12-10-3-1-2-4-11(10)14-9-5-7-13-8-6-9;2-1(3)4/h1-4,9,13H,5-8H2;(H2,2,3,4).
What are the key properties of carbonic acid;4-(2-chlorophenoxy)piperidine?
carbonic acid;4-(2-chlorophenoxy)piperidine has a molecular weight of 273.72 g/mol, XLogP of 2.69, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;4-(2-chlorophenoxy)piperidine is sourced from PubChem (CID 23722971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).