About 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline
2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline (PubChem CID 142482877) has the molecular formula C15H23ClN2O
and a molecular weight of 282.81 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline.
Molecular Properties
| Compound Name | 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline |
| PubChem CID | 142482877 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline |
| SMILES | CCN(CC)c1c(Cl)cccc1OC1CCNCC1 |
| InChI | InChI=1S/C15H23ClN2O/c1-3-18(4-2)15-13(16)6-5-7-14(15)19-12-8-10-17-11-9-12/h5-7,12,17H,3-4,8-11H2,1-2H3 |
| InChIKey | HMXOVQNKEPEPEG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline?
The IUPAC name of 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline (CID 142482877) is 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline.
What is the SMILES notation for 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline?
The canonical SMILES for 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline is CCN(CC)c1c(Cl)cccc1OC1CCNCC1.
What is the InChIKey of 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline?
The InChIKey is HMXOVQNKEPEPEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClN2O/c1-3-18(4-2)15-13(16)6-5-7-14(15)19-12-8-10-17-11-9-12/h5-7,12,17H,3-4,8-11H2,1-2H3.
What are the key properties of 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline?
2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline has a molecular weight of 282.81 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-diethyl-6-piperidin-4-yloxyaniline is sourced from PubChem (CID 142482877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).