C27H21ClF3N5O2S — CID 23724083
4-(4-chloro-3-nitrophenyl)-N-[1-[1-[(4-methylphenyl)methyl]-5-(trifluoromethyl)benzimidazol-2-yl]ethyl]-1,3-thiazol-2-amine (PubChem CID 23724083) has the molecular formula C27H21ClF3N5O2S and a molecular weight of 572.01 g/mol. Its IUPAC name is 4-(4-chloro-3-nitrophenyl)-N-[1-[1-[(4-methylphenyl)methyl]-5-(trifluoromethyl)benzimidazol-2-yl]ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chloro-3-nitrophenyl)-N-[1-[1-[(4-methylphenyl)methyl]-5-(trifluoromethyl)benzimidazol-2-yl]ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 23724083 |
| Molecular Formula | C27H21ClF3N5O2S |
| Molecular Weight | 572.01 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 4-(4-chloro-3-nitrophenyl)-N-[1-[1-[(4-methylphenyl)methyl]-5-(trifluoromethyl)benzimidazol-2-yl]ethyl]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Cn2c(C(C)Nc3nc(-c4ccc(Cl)c([N+](=O)[O-])c4)cs3)nc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C27H21ClF3N5O2S/c1-15-3-5-17(6-4-15)13-35-23-10-8-19(27(29,30)31)12-21(23)33-25(35)16(2)32-26-34-22(14-39-26)18-7-9-20(28)24(11-18)36(37)38/h3-12,14,16H,13H2,1-2H3,(H,32,34) |
| InChIKey | SETLSKCTIVDIHS-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.01 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|