C17H17N3O5 — CID 2372591
2-[2-[2-(4-methoxyphenoxy)acetyl]hydrazinyl]-2-oxo-N-phenylacetamide (PubChem CID 2372591) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-[2-[2-(4-methoxyphenoxy)acetyl]hydrazinyl]-2-oxo-N-phenylacetamide.
| Compound Name | 2-[2-[2-(4-methoxyphenoxy)acetyl]hydrazinyl]-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 2372591 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-[2-[2-(4-methoxyphenoxy)acetyl]hydrazinyl]-2-oxo-N-phenylacetamide |
| SMILES | COc1ccc(OCC(=O)NNC(=O)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17N3O5/c1-24-13-7-9-14(10-8-13)25-11-15(21)19-20-17(23)16(22)18-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | LANZEYAOYJGKIQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|