C13H26O4Si — CID 23726631
2-[(2S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolan-2-yl]acetic acid (PubChem CID 23726631) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-[(2S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolan-2-yl]acetic acid.
| Compound Name | 2-[(2S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 23726631 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-[(2S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolan-2-yl]acetic acid |
| SMILES | C[C@@H]1O[C@H](CC(=O)O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O4Si/c1-9-11(7-10(16-9)8-12(14)15)17-18(5,6)13(2,3)4/h9-11H,7-8H2,1-6H3,(H,14,15)/t9-,10-,11+/m0/s1 |
| InChIKey | DZDGKIHTXKYPLW-GARJFASQSA-N |
| XLogP | 3.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|