C14H26O5Si — CID 139050176
(2R,3R,3aR,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1-hydroxyethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 139050176) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is (2R,3R,3aR,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1-hydroxyethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2R,3R,3aR,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1-hydroxyethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 139050176 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2R,3R,3aR,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1-hydroxyethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | C[C@H](O)[C@H]1O[C@H]2CC(=O)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O5Si/c1-8(15)11-13(19-20(5,6)14(2,3)4)12-9(17-11)7-10(16)18-12/h8-9,11-13,15H,7H2,1-6H3/t8-,9-,11+,12+,13+/m0/s1 |
| InChIKey | QODGIXAKZQVOJV-MAMCYAMTSA-N |
| XLogP | 1.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|