C10H9Cl2FN2O2 — CID 23726678
ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-iminopropanoate (PubChem CID 23726678) has the molecular formula C10H9Cl2FN2O2 and a molecular weight of 279.10 g/mol. Its IUPAC name is ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-iminopropanoate.
| Compound Name | ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-iminopropanoate |
|---|---|
| PubChem CID | 23726678 |
| Molecular Formula | C10H9Cl2FN2O2 |
| Molecular Weight | 279.10 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-iminopropanoate |
| SMILES | [H]/N=C(\CC(=O)OCC)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C10H9Cl2FN2O2/c1-2-17-8(16)4-7(14)5-3-6(13)10(12)15-9(5)11/h3,14H,2,4H2,1H3/b14-7+ |
| InChIKey | OTQJOUZFYCLDRX-VGOFMYFVSA-N |
| XLogP | 2.85 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|