C17H15Cl2FN2O2 — CID 54270432
ethyl 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)methyl]-3-phenyliminopropanoate (PubChem CID 54270432) has the molecular formula C17H15Cl2FN2O2 and a molecular weight of 369.22 g/mol. Its IUPAC name is ethyl 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)methyl]-3-phenyliminopropanoate.
| Compound Name | ethyl 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)methyl]-3-phenyliminopropanoate |
|---|---|
| PubChem CID | 54270432 |
| Molecular Formula | C17H15Cl2FN2O2 |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | ethyl 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)methyl]-3-phenyliminopropanoate |
| SMILES | CCOC(=O)C(/C=N/c1ccccc1)Cc1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C17H15Cl2FN2O2/c1-2-24-17(23)12(10-21-13-6-4-3-5-7-13)8-11-9-14(20)16(19)22-15(11)18/h3-7,9-10,12H,2,8H2,1H3/b21-10+ |
| InChIKey | RJSMWMSSYOZNDU-UFFVCSGVSA-N |
| XLogP | 4.65 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|