C16H13Cl2F2N3O2 — CID 54546627
ethyl 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)methyl]-3-[(5-fluoro-2-pyridinyl)imino]propanoate (PubChem CID 54546627) has the molecular formula C16H13Cl2F2N3O2 and a molecular weight of 388.20 g/mol. Its IUPAC name is ethyl 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)methyl]-3-[(5-fluoro-2-pyridinyl)imino]propanoate.
| Compound Name | ethyl 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)methyl]-3-[(5-fluoro-2-pyridinyl)imino]propanoate |
|---|---|
| PubChem CID | 54546627 |
| Molecular Formula | C16H13Cl2F2N3O2 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | ethyl 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)methyl]-3-[(5-fluoro-2-pyridinyl)imino]propanoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(F)cn1)Cc1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C16H13Cl2F2N3O2/c1-2-25-16(24)10(7-21-13-4-3-11(19)8-22-13)5-9-6-12(20)15(18)23-14(9)17/h3-4,6-8,10H,2,5H2,1H3/b21-7+ |
| InChIKey | ZGYRKFWCFHMIAD-QPSGOUHRSA-N |
| XLogP | 4.19 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|