About 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide
10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide (PubChem CID 23726955) has the molecular formula C15H11Br3N2
and a molecular weight of 458.98 g/mol. Its IUPAC name is 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide.
Molecular Properties
| Compound Name | 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide |
| PubChem CID | 23726955 |
| Molecular Formula | C15H11Br3N2 |
| Molecular Weight | 458.98 g/mol |
| Exact Mass | 455.85 |
| IUPAC Name | 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide |
| SMILES | BrBr.C[n+]1c2ccccc2c(C#N)c2ccccc21.[Br-] |
| InChI | InChI=1S/C15H11N2.Br2.BrH/c1-17-14-8-4-2-6-11(14)13(10-16)12-7-3-5-9-15(12)17;1-2;/h2-9H,1H3;;1H/q+1;;/p-1 |
| InChIKey | HEZLODJHYOXXEF-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.98 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide?
The IUPAC name of 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide (CID 23726955) is 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide.
What is the SMILES notation for 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide?
The canonical SMILES for 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide is BrBr.C[n+]1c2ccccc2c(C#N)c2ccccc21.[Br-].
What is the InChIKey of 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide?
The InChIKey is HEZLODJHYOXXEF-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H11N2.Br2.BrH/c1-17-14-8-4-2-6-11(14)13(10-16)12-7-3-5-9-15(12)17;1-2;/h2-9H,1H3;;1H/q+1;;/p-1.
What are the key properties of 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide?
10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide has a molecular weight of 458.98 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylacridin-10-ium-9-carbonitrile;molecular bromine;bromide is sourced from PubChem (CID 23726955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).