C21H26O2 — CID 23727510
2,6-dibutyl-3-prop-2-enylfuro[2,3-f][1]benzofuran (PubChem CID 23727510) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2,6-dibutyl-3-prop-2-enylfuro[2,3-f][1]benzofuran.
| Compound Name | 2,6-dibutyl-3-prop-2-enylfuro[2,3-f][1]benzofuran |
|---|---|
| PubChem CID | 23727510 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2,6-dibutyl-3-prop-2-enylfuro[2,3-f][1]benzofuran |
| SMILES | C=CCc1c(CCCC)oc2cc3cc(CCCC)oc3cc12 |
| InChI | InChI=1S/C21H26O2/c1-4-7-10-16-12-15-13-21-18(14-20(15)22-16)17(9-6-3)19(23-21)11-8-5-2/h6,12-14H,3-5,7-11H2,1-2H3 |
| InChIKey | AKINPJWFKXBUEB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|