C16H21NO2S — CID 2372897
(3E)-1-(2-hydroxyethylsulfanyl)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one (PubChem CID 2372897) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is (3E)-1-(2-hydroxyethylsulfanyl)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one.
| Compound Name | (3E)-1-(2-hydroxyethylsulfanyl)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 2372897 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (3E)-1-(2-hydroxyethylsulfanyl)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
| SMILES | CN1/C(=C/C(=O)CSCCO)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C16H21NO2S/c1-16(2)13-6-4-5-7-14(13)17(3)15(16)10-12(19)11-20-9-8-18/h4-7,10,18H,8-9,11H2,1-3H3/b15-10+ |
| InChIKey | OGGNFGOCXSJTHU-XNTDXEJSSA-N |
| XLogP | 2.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|