C22H23N3O2 — CID 23730280
N-cyclopropyl-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxamide (PubChem CID 23730280) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-cyclopropyl-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxamide.
| Compound Name | N-cyclopropyl-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 23730280 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-cyclopropyl-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxamide |
| SMILES | Cc1nc2c3c(c(C(=O)NC4CC4)cn2c1C)CCC(c1ccccc1)O3 |
| InChI | InChI=1S/C22H23N3O2/c1-13-14(2)25-12-18(22(26)24-16-8-9-16)17-10-11-19(15-6-4-3-5-7-15)27-20(17)21(25)23-13/h3-7,12,16,19H,8-11H2,1-2H3,(H,24,26) |
| InChIKey | SFNDFWXAFJROAQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |