C26H33Cl4N7O2 — CID 23730507
(2S,4S)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]-1-[(2,4-dichlorophenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 23730507) has the molecular formula C26H33Cl4N7O2 and a molecular weight of 617.41 g/mol. Its IUPAC name is (2S,4S)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]-1-[(2,4-dichlorophenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]-1-[(2,4-dichlorophenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23730507 |
| Molecular Formula | C26H33Cl4N7O2 |
| Molecular Weight | 617.41 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | (2S,4S)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]-1-[(2,4-dichlorophenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)N[C@H]1C[C@@H](C(=O)NCCc2ccc(Cl)cc2Cl)N(Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C26H33Cl4N7O2/c27-17-5-3-15(20(29)10-17)7-9-34-25(39)23-12-19(36-24(38)22(31)2-1-8-35-26(32)33)14-37(23)13-16-4-6-18(28)11-21(16)30/h3-6,10-11,19,22-23H,1-2,7-9,12-14,31H2,(H,34,39)(H,36,38)(H4,32,33,35)/t19-,22-,23-/m0/s1 |
| InChIKey | YBNTYYLISGNKJM-VJBMBRPKSA-N |
| XLogP | 3.10 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|