C26H33Cl4N7O3 — CID 10439054
(2S)-2-amino-N-[2-[(2-amino-2-oxoethyl)-[2-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl]-5-(diaminomethylideneamino)-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide (PubChem CID 10439054) has the molecular formula C26H33Cl4N7O3 and a molecular weight of 633.41 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[(2-amino-2-oxoethyl)-[2-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl]-5-(diaminomethylideneamino)-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide.
| Compound Name | (2S)-2-amino-N-[2-[(2-amino-2-oxoethyl)-[2-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl]-5-(diaminomethylideneamino)-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 10439054 |
| Molecular Formula | C26H33Cl4N7O3 |
| Molecular Weight | 633.41 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | (2S)-2-amino-N-[2-[(2-amino-2-oxoethyl)-[2-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl]-5-(diaminomethylideneamino)-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide |
| SMILES | NC(=O)CN(CCc1ccc(Cl)cc1Cl)C(=O)CN(CCc1ccc(Cl)cc1Cl)C(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C26H33Cl4N7O3/c27-18-5-3-16(20(29)12-18)7-10-36(14-23(32)38)24(39)15-37(11-8-17-4-6-19(28)13-21(17)30)25(40)22(31)2-1-9-35-26(33)34/h3-6,12-13,22H,1-2,7-11,14-15,31H2,(H2,32,38)(H4,33,34,35)/t22-/m0/s1 |
| InChIKey | JSQFOUMIWIGWDW-QFIPXVFZSA-N |
| XLogP | 2.61 |
| TPSA | 174.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|