C23H20N2O5S2 — CID 2373283
(2-oxo-2-phenothiazin-10-ylethyl) 2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 2373283) has the molecular formula C23H20N2O5S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 2373283 |
| Molecular Formula | C23H20N2O5S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)OCC(=O)N2c3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C23H20N2O5S2/c1-16-10-12-17(13-11-16)32(28,29)24-14-23(27)30-15-22(26)25-18-6-2-4-8-20(18)31-21-9-5-3-7-19(21)25/h2-13,24H,14-15H2,1H3 |
| InChIKey | DBYPHKDTAQWZTO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |