C16H20N4O3S — CID 23733180
N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]-1-methylpyrazole-3-carboxamide (PubChem CID 23733180) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 23733180 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]-1-methylpyrazole-3-carboxamide |
| SMILES | COc1ccc(CCNC(=S)NC(=O)c2ccn(C)n2)cc1OC |
| InChI | InChI=1S/C16H20N4O3S/c1-20-9-7-12(19-20)15(21)18-16(24)17-8-6-11-4-5-13(22-2)14(10-11)23-3/h4-5,7,9-10H,6,8H2,1-3H3,(H2,17,18,21,24) |
| InChIKey | UKZBOKGGIIPHPF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|