C18H24N4O3S — CID 2210583
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[2-(1-methylpyrrol-2-yl)acetyl]amino]thiourea (PubChem CID 2210583) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[2-(1-methylpyrrol-2-yl)acetyl]amino]thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[2-(1-methylpyrrol-2-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 2210583 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[2-(1-methylpyrrol-2-yl)acetyl]amino]thiourea |
| SMILES | COc1ccc(CCNC(=S)NNC(=O)Cc2cccn2C)cc1OC |
| InChI | InChI=1S/C18H24N4O3S/c1-22-10-4-5-14(22)12-17(23)20-21-18(26)19-9-8-13-6-7-15(24-2)16(11-13)25-3/h4-7,10-11H,8-9,12H2,1-3H3,(H,20,23)(H2,19,21,26) |
| InChIKey | HGKYQLLIBJQNCL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|