C20H24FN3O3S — CID 9428703
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[3-(2-fluorophenyl)propanoylamino]thiourea (PubChem CID 9428703) has the molecular formula C20H24FN3O3S and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[3-(2-fluorophenyl)propanoylamino]thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[3-(2-fluorophenyl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 9428703 |
| Molecular Formula | C20H24FN3O3S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[3-(2-fluorophenyl)propanoylamino]thiourea |
| SMILES | COc1ccc(CCNC(=S)NNC(=O)CCc2ccccc2F)cc1OC |
| InChI | InChI=1S/C20H24FN3O3S/c1-26-17-9-7-14(13-18(17)27-2)11-12-22-20(28)24-23-19(25)10-8-15-5-3-4-6-16(15)21/h3-7,9,13H,8,10-12H2,1-2H3,(H,23,25)(H2,22,24,28) |
| InChIKey | JGLKBVVVYKKFHW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|