C16H22N4O4S2 — CID 9089514
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]thiourea (PubChem CID 9089514) has the molecular formula C16H22N4O4S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9089514 |
| Molecular Formula | C16H22N4O4S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]thiourea |
| SMILES | COc1ccc(CCNC(=S)NNC(=O)CN2CCSC2=O)cc1OC |
| InChI | InChI=1S/C16H22N4O4S2/c1-23-12-4-3-11(9-13(12)24-2)5-6-17-15(25)19-18-14(21)10-20-7-8-26-16(20)22/h3-4,9H,5-8,10H2,1-2H3,(H,18,21)(H2,17,19,25) |
| InChIKey | NKIGMMHITNWKPU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|