C16H27N4O2S+ — CID 7223723
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methylpiperazin-4-ium-1-yl)thiourea (PubChem CID 7223723) has the molecular formula C16H27N4O2S+ and a molecular weight of 339.49 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methylpiperazin-4-ium-1-yl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methylpiperazin-4-ium-1-yl)thiourea |
|---|---|
| PubChem CID | 7223723 |
| Molecular Formula | C16H27N4O2S+ |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methylpiperazin-4-ium-1-yl)thiourea |
| SMILES | COc1ccc(CCNC(=S)NN2CC[NH+](C)CC2)cc1OC |
| InChI | InChI=1S/C16H26N4O2S/c1-19-8-10-20(11-9-19)18-16(23)17-7-6-13-4-5-14(21-2)15(12-13)22-3/h4-5,12H,6-11H2,1-3H3,(H2,17,18,23)/p+1 |
| InChIKey | RCQLTTVRNBTXBR-UHFFFAOYSA-O |
| XLogP | -0.54 |
| TPSA | 50.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|