C22H25N3O2 — CID 23734012
ethyl 3-[(2-pentan-3-ylquinazolin-4-yl)amino]benzoate (PubChem CID 23734012) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 3-[(2-pentan-3-ylquinazolin-4-yl)amino]benzoate.
| Compound Name | ethyl 3-[(2-pentan-3-ylquinazolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 23734012 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | ethyl 3-[(2-pentan-3-ylquinazolin-4-yl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2nc(C(CC)CC)nc3ccccc23)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-4-15(5-2)20-24-19-13-8-7-12-18(19)21(25-20)23-17-11-9-10-16(14-17)22(26)27-6-3/h7-15H,4-6H2,1-3H3,(H,23,24,25) |
| InChIKey | ZZSZPUSPSUWBIP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |