C25H25N5O6 — CID 23734786
N-[[3-(aminomethyl)phenyl]methyl]-1-(3-methylbenzoyl)-3-(5-nitrofuran-2-carbonyl)imidazolidine-2-carboxamide (PubChem CID 23734786) has the molecular formula C25H25N5O6 and a molecular weight of 491.50 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-1-(3-methylbenzoyl)-3-(5-nitrofuran-2-carbonyl)imidazolidine-2-carboxamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-1-(3-methylbenzoyl)-3-(5-nitrofuran-2-carbonyl)imidazolidine-2-carboxamide |
|---|---|
| PubChem CID | 23734786 |
| Molecular Formula | C25H25N5O6 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-1-(3-methylbenzoyl)-3-(5-nitrofuran-2-carbonyl)imidazolidine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])o3)C2C(=O)NCc2cccc(CN)c2)c1 |
| InChI | InChI=1S/C25H25N5O6/c1-16-4-2-7-19(12-16)24(32)28-10-11-29(25(33)20-8-9-21(36-20)30(34)35)23(28)22(31)27-15-18-6-3-5-17(13-18)14-26/h2-9,12-13,23H,10-11,14-15,26H2,1H3,(H,27,31) |
| InChIKey | WQWZGJXSHSOBAM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 152.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|