C26H26ClN5O3 — CID 23937900
N-[[3-(aminomethyl)phenyl]methyl]-1-(6-chloropyridine-3-carbonyl)-3-(4-methylbenzoyl)imidazolidine-2-carboxamide (PubChem CID 23937900) has the molecular formula C26H26ClN5O3 and a molecular weight of 491.98 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-1-(6-chloropyridine-3-carbonyl)-3-(4-methylbenzoyl)imidazolidine-2-carboxamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-1-(6-chloropyridine-3-carbonyl)-3-(4-methylbenzoyl)imidazolidine-2-carboxamide |
|---|---|
| PubChem CID | 23937900 |
| Molecular Formula | C26H26ClN5O3 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-1-(6-chloropyridine-3-carbonyl)-3-(4-methylbenzoyl)imidazolidine-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)c3ccc(Cl)nc3)C2C(=O)NCc2cccc(CN)c2)cc1 |
| InChI | InChI=1S/C26H26ClN5O3/c1-17-5-7-20(8-6-17)25(34)31-11-12-32(26(35)21-9-10-22(27)29-16-21)24(31)23(33)30-15-19-4-2-3-18(13-19)14-28/h2-10,13,16,24H,11-12,14-15,28H2,1H3,(H,30,33) |
| InChIKey | JBCPTHXDFNBQEY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|