C13H12N2OS — CID 23737971
3-(1,3-benzothiazol-2-ylamino)cyclohex-2-en-1-one (PubChem CID 23737971) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylamino)cyclohex-2-en-1-one.
| Compound Name | 3-(1,3-benzothiazol-2-ylamino)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 23737971 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylamino)cyclohex-2-en-1-one |
| SMILES | O=C1C=C(Nc2nc3ccccc3s2)CCC1 |
| InChI | InChI=1S/C13H12N2OS/c16-10-5-3-4-9(8-10)14-13-15-11-6-1-2-7-12(11)17-13/h1-2,6-8H,3-5H2,(H,14,15) |
| InChIKey | GFRUZYSHYNUXCU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |