C26H19ClN2O5S — CID 23739745
(4E)-1-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2,4-dimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 23739745) has the molecular formula C26H19ClN2O5S and a molecular weight of 506.97 g/mol. Its IUPAC name is (4E)-1-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2,4-dimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2,4-dimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 23739745 |
| Molecular Formula | C26H19ClN2O5S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | (4E)-1-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2,4-dimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3ccc(Cl)cc3)C(=O)C(=O)N2c2nc3ccccc3s2)c(OC)c1 |
| InChI | InChI=1S/C26H19ClN2O5S/c1-33-16-11-12-17(19(13-16)34-2)22-21(23(30)14-7-9-15(27)10-8-14)24(31)25(32)29(22)26-28-18-5-3-4-6-20(18)35-26/h3-13,22,30H,1-2H3/b23-21+ |
| InChIKey | GKUBLOPJRRWGHF-XTQSDGFTSA-N |
| XLogP | 5.59 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|