C23H21NO2 — CID 23741618
2-hydroxy-N-[2-(3-methylphenyl)ethenyl]-2,2-diphenylacetamide (PubChem CID 23741618) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(3-methylphenyl)ethenyl]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[2-(3-methylphenyl)ethenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 23741618 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-hydroxy-N-[2-(3-methylphenyl)ethenyl]-2,2-diphenylacetamide |
| SMILES | Cc1cccc(C=CNC(=O)C(O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21NO2/c1-18-9-8-10-19(17-18)15-16-24-22(25)23(26,20-11-4-2-5-12-20)21-13-6-3-7-14-21/h2-17,26H,1H3,(H,24,25) |
| InChIKey | ANBZNVVAJHEXFR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |