C23H22N4O8 — CID 23741800
2-(2-methoxyacetyl)-1-(4-methoxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxamide (PubChem CID 23741800) has the molecular formula C23H22N4O8 and a molecular weight of 482.45 g/mol. Its IUPAC name is 2-(2-methoxyacetyl)-1-(4-methoxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxamide.
| Compound Name | 2-(2-methoxyacetyl)-1-(4-methoxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 23741800 |
| Molecular Formula | C23H22N4O8 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-(2-methoxyacetyl)-1-(4-methoxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxamide |
| SMILES | COCC(=O)N1C(C(N)=O)C2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)C2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H22N4O8/c1-34-11-16(28)26-19(12-6-8-15(35-2)9-7-12)17-18(20(26)21(24)29)23(31)25(22(17)30)13-4-3-5-14(10-13)27(32)33/h3-10,17-20H,11H2,1-2H3,(H2,24,29) |
| InChIKey | MEKMEZLNCSTDOU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|