C23H24N4O5 — CID 23931702
2-N-ethyl-1-(4-methoxyphenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-2,3-dicarboxamide (PubChem CID 23931702) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-N-ethyl-1-(4-methoxyphenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-2,3-dicarboxamide.
| Compound Name | 2-N-ethyl-1-(4-methoxyphenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-2,3-dicarboxamide |
|---|---|
| PubChem CID | 23931702 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-N-ethyl-1-(4-methoxyphenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-2,3-dicarboxamide |
| SMILES | CCNC(=O)N1C(C(N)=O)C2C(=O)N(c3ccccc3)C(=O)C2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H24N4O5/c1-3-25-23(31)27-18(13-9-11-15(32-2)12-10-13)16-17(19(27)20(24)28)22(30)26(21(16)29)14-7-5-4-6-8-14/h4-12,16-19H,3H2,1-2H3,(H2,24,28)(H,25,31) |
| InChIKey | VYGMYYBVPJMOOR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|