C26H24IN3OS — CID 23743182
2-[(3-cyano-6-phenyl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide (PubChem CID 23743182) has the molecular formula C26H24IN3OS and a molecular weight of 553.47 g/mol. Its IUPAC name is 2-[(3-cyano-6-phenyl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide.
| Compound Name | 2-[(3-cyano-6-phenyl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide |
|---|---|
| PubChem CID | 23743182 |
| Molecular Formula | C26H24IN3OS |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | 2-[(3-cyano-6-phenyl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide |
| SMILES | CCC(Sc1nc2c(cc1C#N)CC(c1ccccc1)CC2)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C26H24IN3OS/c1-2-24(25(31)29-22-11-9-21(27)10-12-22)32-26-20(16-28)15-19-14-18(8-13-23(19)30-26)17-6-4-3-5-7-17/h3-7,9-12,15,18,24H,2,8,13-14H2,1H3,(H,29,31) |
| InChIKey | UIPBCVAJPXVVCE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|