C32H31N3OS — CID 23744254
2-[1-oxo-1-(1,2,3,4-tetrahydrocarbazol-9-yl)butan-2-yl]sulfanyl-6-phenyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 23744254) has the molecular formula C32H31N3OS and a molecular weight of 505.69 g/mol. Its IUPAC name is 2-[1-oxo-1-(1,2,3,4-tetrahydrocarbazol-9-yl)butan-2-yl]sulfanyl-6-phenyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-[1-oxo-1-(1,2,3,4-tetrahydrocarbazol-9-yl)butan-2-yl]sulfanyl-6-phenyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23744254 |
| Molecular Formula | C32H31N3OS |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2-[1-oxo-1-(1,2,3,4-tetrahydrocarbazol-9-yl)butan-2-yl]sulfanyl-6-phenyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CCC(Sc1nc2c(cc1C#N)CC(c1ccccc1)CC2)C(=O)n1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C32H31N3OS/c1-2-30(32(36)35-28-14-8-6-12-25(28)26-13-7-9-15-29(26)35)37-31-24(20-33)19-23-18-22(16-17-27(23)34-31)21-10-4-3-5-11-21/h3-6,8,10-12,14,19,22,30H,2,7,9,13,15-18H2,1H3 |
| InChIKey | BQSFZMQNJXEGBA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |