C27H26N4O3 — CID 23744555
[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl] 3H-benzimidazole-5-carboxylate (PubChem CID 23744555) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is [2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl] 3H-benzimidazole-5-carboxylate.
| Compound Name | [2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl] 3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23744555 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl] 3H-benzimidazole-5-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C27H26N4O3/c32-25(18-34-27(33)22-11-12-23-24(17-22)29-19-28-23)30-13-15-31(16-14-30)26(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-12,17,19,26H,13-16,18H2,(H,28,29) |
| InChIKey | IGBAFNUNQOHQIU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |