C24H26N2O6S — CID 23744892
[1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl] 1,3-benzoxazole-4-carboxylate (PubChem CID 23744892) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl] 1,3-benzoxazole-4-carboxylate.
| Compound Name | [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl] 1,3-benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 23744892 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl] 1,3-benzoxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)OC(=O)c2cccc3ocnc23)sc2c1CCCCCC2 |
| InChI | InChI=1S/C24H26N2O6S/c1-3-30-24(29)19-15-9-6-4-5-7-12-18(15)33-22(19)26-21(27)14(2)32-23(28)16-10-8-11-17-20(16)25-13-31-17/h8,10-11,13-14H,3-7,9,12H2,1-2H3,(H,26,27) |
| InChIKey | LOVDJKNLJIFEGM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |