C35H38N2O6S — CID 23745134
[1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxobutan-2-yl] 2-methyl-4-(4-methylphenyl)-1-oxoisoquinoline-3-carboxylate (PubChem CID 23745134) has the molecular formula C35H38N2O6S and a molecular weight of 614.76 g/mol. Its IUPAC name is [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxobutan-2-yl] 2-methyl-4-(4-methylphenyl)-1-oxoisoquinoline-3-carboxylate.
| Compound Name | [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxobutan-2-yl] 2-methyl-4-(4-methylphenyl)-1-oxoisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 23745134 |
| Molecular Formula | C35H38N2O6S |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxobutan-2-yl] 2-methyl-4-(4-methylphenyl)-1-oxoisoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)OC(=O)c2c(-c3ccc(C)cc3)c3ccccc3c(=O)n2C)sc2c1CCCCCC2 |
| InChI | InChI=1S/C35H38N2O6S/c1-5-26(31(38)36-32-29(34(40)42-6-2)25-15-9-7-8-10-16-27(25)44-32)43-35(41)30-28(22-19-17-21(3)18-20-22)23-13-11-12-14-24(23)33(39)37(30)4/h11-14,17-20,26H,5-10,15-16H2,1-4H3,(H,36,38) |
| InChIKey | LFEGIBYHZYPNGO-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |