C23H28N2O5S — CID 23916380
[1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxobutan-2-yl] pyridine-3-carboxylate (PubChem CID 23916380) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxobutan-2-yl] pyridine-3-carboxylate.
| Compound Name | [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxobutan-2-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 23916380 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxobutan-2-yl] pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)OC(=O)c2cccnc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C23H28N2O5S/c1-3-17(30-22(27)15-10-9-13-24-14-15)20(26)25-21-19(23(28)29-4-2)16-11-7-5-6-8-12-18(16)31-21/h9-10,13-14,17H,3-8,11-12H2,1-2H3,(H,25,26) |
| InChIKey | OCJNPOJBEYTQMU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |