C28H21ClN2O2S — CID 23745560
5-(4-chlorophenyl)-7-phenyl-2-[(3-prop-2-enoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 23745560) has the molecular formula C28H21ClN2O2S and a molecular weight of 485.01 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-7-phenyl-2-[(3-prop-2-enoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
| Compound Name | 5-(4-chlorophenyl)-7-phenyl-2-[(3-prop-2-enoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 23745560 |
| Molecular Formula | C28H21ClN2O2S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 5-(4-chlorophenyl)-7-phenyl-2-[(3-prop-2-enoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | C=CCOc1cccc(C=c2sc3n(c2=O)C(c2ccc(Cl)cc2)C=C(c2ccccc2)N=3)c1 |
| InChI | InChI=1S/C28H21ClN2O2S/c1-2-15-33-23-10-6-7-19(16-23)17-26-27(32)31-25(21-11-13-22(29)14-12-21)18-24(30-28(31)34-26)20-8-4-3-5-9-20/h2-14,16-18,25H,1,15H2 |
| InChIKey | FQRKLNAVIOODMZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|