C24H19ClN2O3S — CID 23910737
prop-2-enyl 2-benzylidene-5-(4-chlorophenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 23910737) has the molecular formula C24H19ClN2O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is prop-2-enyl 2-benzylidene-5-(4-chlorophenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 2-benzylidene-5-(4-chlorophenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23910737 |
| Molecular Formula | C24H19ClN2O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | prop-2-enyl 2-benzylidene-5-(4-chlorophenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=c2sc(=Cc3ccccc3)c(=O)n2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN2O3S/c1-3-13-30-23(29)20-15(2)26-24-27(21(20)17-9-11-18(25)12-10-17)22(28)19(31-24)14-16-7-5-4-6-8-16/h3-12,14,21H,1,13H2,2H3 |
| InChIKey | SDZDPTTUVAACSI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|