C26H22N2O5S — CID 3692255
prop-2-enyl 2-[(4-acetyloxyphenyl)methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3692255) has the molecular formula C26H22N2O5S and a molecular weight of 474.54 g/mol. Its IUPAC name is prop-2-enyl 2-[(4-acetyloxyphenyl)methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 2-[(4-acetyloxyphenyl)methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3692255 |
| Molecular Formula | C26H22N2O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | prop-2-enyl 2-[(4-acetyloxyphenyl)methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(OC(C)=O)cc3)c(=O)n2C1c1ccccc1 |
| InChI | InChI=1S/C26H22N2O5S/c1-4-14-32-25(31)22-16(2)27-26-28(23(22)19-8-6-5-7-9-19)24(30)21(34-26)15-18-10-12-20(13-11-18)33-17(3)29/h4-13,15,23H,1,14H2,2-3H3 |
| InChIKey | HZXDCKOMCZPBLS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|