C25H24BIN2O8 — CID 23747767
(3aS,8S,9aS,9bR)-5-ethyl-6-hydroxy-8-(4-hydroxy-3-iodo-5-methoxyphenyl)-2-(3-nitrophenyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione (PubChem CID 23747767) has the molecular formula C25H24BIN2O8 and a molecular weight of 618.19 g/mol. Its IUPAC name is (3aS,8S,9aS,9bR)-5-ethyl-6-hydroxy-8-(4-hydroxy-3-iodo-5-methoxyphenyl)-2-(3-nitrophenyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aS,8S,9aS,9bR)-5-ethyl-6-hydroxy-8-(4-hydroxy-3-iodo-5-methoxyphenyl)-2-(3-nitrophenyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23747767 |
| Molecular Formula | C25H24BIN2O8 |
| Molecular Weight | 618.19 g/mol |
| Exact Mass | 618.07 |
| IUPAC Name | (3aS,8S,9aS,9bR)-5-ethyl-6-hydroxy-8-(4-hydroxy-3-iodo-5-methoxyphenyl)-2-(3-nitrophenyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
| SMILES | CCC1=C2B(O)O[C@H](c3cc(I)c(O)c(OC)c3)C[C@H]2[C@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C25H24BIN2O8/c1-3-12-7-17-21(25(32)28(24(17)31)14-5-4-6-15(10-14)29(34)35)16-11-19(37-26(33)22(12)16)13-8-18(27)23(30)20(9-13)36-2/h4-6,8-10,16-17,19,21,30,33H,3,7,11H2,1-2H3/t16-,17-,19-,21+/m0/s1 |
| InChIKey | NSFARXWQHXAZKV-MEZWHVQBSA-N |
| XLogP | 3.93 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|