C26H27BN2O8 — CID 23946898
(3aS,8S,9aS,9bR)-6-hydroxy-8-(4-hydroxy-3,5-dimethylphenyl)-5-(methoxymethyl)-2-(3-nitrophenyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione (PubChem CID 23946898) has the molecular formula C26H27BN2O8 and a molecular weight of 506.32 g/mol. Its IUPAC name is (3aS,8S,9aS,9bR)-6-hydroxy-8-(4-hydroxy-3,5-dimethylphenyl)-5-(methoxymethyl)-2-(3-nitrophenyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aS,8S,9aS,9bR)-6-hydroxy-8-(4-hydroxy-3,5-dimethylphenyl)-5-(methoxymethyl)-2-(3-nitrophenyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23946898 |
| Molecular Formula | C26H27BN2O8 |
| Molecular Weight | 506.32 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (3aS,8S,9aS,9bR)-6-hydroxy-8-(4-hydroxy-3,5-dimethylphenyl)-5-(methoxymethyl)-2-(3-nitrophenyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
| SMILES | COCC1=C2B(O)O[C@H](c3cc(C)c(O)c(C)c3)C[C@H]2[C@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C26H27BN2O8/c1-13-7-15(8-14(2)24(13)30)21-11-19-22-20(9-16(12-36-3)23(19)27(33)37-21)25(31)28(26(22)32)17-5-4-6-18(10-17)29(34)35/h4-8,10,19-22,30,33H,9,11-12H2,1-3H3/t19-,20-,21-,22+/m0/s1 |
| InChIKey | SYDRSJGKBVXXRE-MYGLTJDJSA-N |
| XLogP | 3.17 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|