C39H40BNO6Si — CID 23974951
(3aS,8S,9aS,9bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-8-(2-hydroxyphenyl)-2-phenyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione (PubChem CID 23974951) has the molecular formula C39H40BNO6Si and a molecular weight of 657.65 g/mol. Its IUPAC name is (3aS,8S,9aS,9bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-8-(2-hydroxyphenyl)-2-phenyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aS,8S,9aS,9bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-8-(2-hydroxyphenyl)-2-phenyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23974951 |
| Molecular Formula | C39H40BNO6Si |
| Molecular Weight | 657.65 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | (3aS,8S,9aS,9bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-8-(2-hydroxyphenyl)-2-phenyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](OCC1=C2B(O)O[C@H](c3ccccc3O)C[C@H]2[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H40BNO6Si/c1-39(2,3)48(28-17-9-5-10-18-28,29-19-11-6-12-20-29)46-25-26-23-32-35(38(44)41(37(32)43)27-15-7-4-8-16-27)31-24-34(47-40(45)36(26)31)30-21-13-14-22-33(30)42/h4-22,31-32,34-35,42,45H,23-25H2,1-3H3/t31-,32-,34-,35+/m0/s1 |
| InChIKey | ULSXCHRLOFEBST-NFDQIHTRSA-N |
| XLogP | 5.57 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|