C27H24BF6NO5 — CID 23863075
(3aS,8S,9aS,9bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-hydroxy-8-(2-hydroxyphenyl)-5-propan-2-yl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione (PubChem CID 23863075) has the molecular formula C27H24BF6NO5 and a molecular weight of 567.29 g/mol. Its IUPAC name is (3aS,8S,9aS,9bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-hydroxy-8-(2-hydroxyphenyl)-5-propan-2-yl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aS,8S,9aS,9bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-hydroxy-8-(2-hydroxyphenyl)-5-propan-2-yl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23863075 |
| Molecular Formula | C27H24BF6NO5 |
| Molecular Weight | 567.29 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | (3aS,8S,9aS,9bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-hydroxy-8-(2-hydroxyphenyl)-5-propan-2-yl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
| SMILES | CC(C)C1=C2B(O)O[C@H](c3ccccc3O)C[C@H]2[C@H]2C(=O)N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C27H24BF6NO5/c1-12(2)17-10-19-22(18-11-21(40-28(39)23(17)18)16-5-3-4-6-20(16)36)25(38)35(24(19)37)15-8-13(26(29,30)31)7-14(9-15)27(32,33)34/h3-9,12,18-19,21-22,36,39H,10-11H2,1-2H3/t18-,19-,21-,22+/m0/s1 |
| InChIKey | FOBDOLVGQZHKKT-BLKABHOGSA-N |
| XLogP | 5.69 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|