C25H31BBrNO5 — CID 23806016
(3aS,8S,9aS,9bR)-8-(5-bromo-2-hydroxyphenyl)-2-cyclohexyl-6-hydroxy-5-propan-2-yl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione (PubChem CID 23806016) has the molecular formula C25H31BBrNO5 and a molecular weight of 516.24 g/mol. Its IUPAC name is (3aS,8S,9aS,9bR)-8-(5-bromo-2-hydroxyphenyl)-2-cyclohexyl-6-hydroxy-5-propan-2-yl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aS,8S,9aS,9bR)-8-(5-bromo-2-hydroxyphenyl)-2-cyclohexyl-6-hydroxy-5-propan-2-yl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23806016 |
| Molecular Formula | C25H31BBrNO5 |
| Molecular Weight | 516.24 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | (3aS,8S,9aS,9bR)-8-(5-bromo-2-hydroxyphenyl)-2-cyclohexyl-6-hydroxy-5-propan-2-yl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
| SMILES | CC(C)C1=C2B(O)O[C@H](c3cc(Br)ccc3O)C[C@H]2[C@H]2C(=O)N(C3CCCCC3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C25H31BBrNO5/c1-13(2)16-11-19-22(25(31)28(24(19)30)15-6-4-3-5-7-15)18-12-21(33-26(32)23(16)18)17-10-14(27)8-9-20(17)29/h8-10,13,15,18-19,21-22,29,32H,3-7,11-12H2,1-2H3/t18-,19-,21-,22+/m0/s1 |
| InChIKey | LPHCOLGZFQSBSK-BLKABHOGSA-N |
| XLogP | 4.54 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|