C31H37BrN2O5 — CID 23946973
(3aS,5S,5aR,7S,8aS,8bR)-2-(1-benzylpiperidin-4-yl)-7-(5-bromo-2-hydroxyphenyl)-5a-hydroxy-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione (PubChem CID 23946973) has the molecular formula C31H37BrN2O5 and a molecular weight of 597.55 g/mol. Its IUPAC name is (3aS,5S,5aR,7S,8aS,8bR)-2-(1-benzylpiperidin-4-yl)-7-(5-bromo-2-hydroxyphenyl)-5a-hydroxy-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,5S,5aR,7S,8aS,8bR)-2-(1-benzylpiperidin-4-yl)-7-(5-bromo-2-hydroxyphenyl)-5a-hydroxy-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23946973 |
| Molecular Formula | C31H37BrN2O5 |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | (3aS,5S,5aR,7S,8aS,8bR)-2-(1-benzylpiperidin-4-yl)-7-(5-bromo-2-hydroxyphenyl)-5a-hydroxy-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
| SMILES | CCC[C@H]1C[C@@H]2C(=O)N(C3CCN(Cc4ccccc4)CC3)C(=O)[C@@H]2[C@@H]2C[C@@H](c3cc(Br)ccc3O)O[C@]12O |
| InChI | InChI=1S/C31H37BrN2O5/c1-2-6-20-15-24-28(25-17-27(39-31(20,25)38)23-16-21(32)9-10-26(23)35)30(37)34(29(24)36)22-11-13-33(14-12-22)18-19-7-4-3-5-8-19/h3-5,7-10,16,20,22,24-25,27-28,35,38H,2,6,11-15,17-18H2,1H3/t20-,24-,25-,27-,28-,31+/m0/s1 |
| InChIKey | GKYKDEZUTFKSMK-NBNVTJIFSA-N |
| XLogP | 5.01 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|