C29H34N2O6 — CID 23863138
(3aS,5R,5aS,7S,8aS,8bR)-2-(1-benzylpiperidin-4-yl)-5a-hydroxy-5-(hydroxymethyl)-7-(2-hydroxyphenyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione (PubChem CID 23863138) has the molecular formula C29H34N2O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is (3aS,5R,5aS,7S,8aS,8bR)-2-(1-benzylpiperidin-4-yl)-5a-hydroxy-5-(hydroxymethyl)-7-(2-hydroxyphenyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,5R,5aS,7S,8aS,8bR)-2-(1-benzylpiperidin-4-yl)-5a-hydroxy-5-(hydroxymethyl)-7-(2-hydroxyphenyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23863138 |
| Molecular Formula | C29H34N2O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (3aS,5R,5aS,7S,8aS,8bR)-2-(1-benzylpiperidin-4-yl)-5a-hydroxy-5-(hydroxymethyl)-7-(2-hydroxyphenyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
| SMILES | O=C1[C@H]2[C@H](C[C@H](CO)[C@@]3(O)O[C@H](c4ccccc4O)C[C@@H]23)C(=O)N1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H34N2O6/c32-17-19-14-22-26(23-15-25(37-29(19,23)36)21-8-4-5-9-24(21)33)28(35)31(27(22)34)20-10-12-30(13-11-20)16-18-6-2-1-3-7-18/h1-9,19-20,22-23,25-26,32-33,36H,10-17H2/t19-,22+,23+,25+,26+,29-/m1/s1 |
| InChIKey | XGFKPTNFLXBAEE-XZCOCZDRSA-N |
| XLogP | 2.44 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|